C15H13N3O2 — CID 10445684
(2S,3R)-2-azido-3-hydroxy-1,3-diphenylpropan-1-one (PubChem CID 10445684) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is (2S,3R)-2-azido-3-hydroxy-1,3-diphenylpropan-1-one.
| Compound Name | (2S,3R)-2-azido-3-hydroxy-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 10445684 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (2S,3R)-2-azido-3-hydroxy-1,3-diphenylpropan-1-one |
| SMILES | [N-]=[N+]=N[C@H](C(=O)c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H13N3O2/c16-18-17-13(14(19)11-7-3-1-4-8-11)15(20)12-9-5-2-6-10-12/h1-10,13-14,19H/t13-,14+/m0/s1 |
| InChIKey | XLHZXJOXFBTJEG-UONOGXRCSA-N |
| XLogP | 3.28 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|