C15H12ClN3O2 — CID 90046539
(2S,3R)-2-azido-3-(4-chlorophenyl)-3-phenylpropanoic acid (PubChem CID 90046539) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is (2S,3R)-2-azido-3-(4-chlorophenyl)-3-phenylpropanoic acid.
| Compound Name | (2S,3R)-2-azido-3-(4-chlorophenyl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90046539 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (2S,3R)-2-azido-3-(4-chlorophenyl)-3-phenylpropanoic acid |
| SMILES | [N-]=[N+]=N[C@H](C(=O)O)[C@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClN3O2/c16-12-8-6-11(7-9-12)13(10-4-2-1-3-5-10)14(15(20)21)18-19-17/h1-9,13-14H,(H,20,21)/t13-,14+/m1/s1 |
| InChIKey | WACBMXZLHFQLJW-KGLIPLIRSA-N |
| XLogP | 4.24 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|