C25H20Cl2N4O3 — CID 90686160
3-[2-azido-3,3-bis(4-chlorophenyl)propanoyl]-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 90686160) has the molecular formula C25H20Cl2N4O3 and a molecular weight of 495.37 g/mol. Its IUPAC name is 3-[2-azido-3,3-bis(4-chlorophenyl)propanoyl]-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-azido-3,3-bis(4-chlorophenyl)propanoyl]-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90686160 |
| Molecular Formula | C25H20Cl2N4O3 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 3-[2-azido-3,3-bis(4-chlorophenyl)propanoyl]-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC(C(=O)N1C(=O)OCC1Cc1ccccc1)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20Cl2N4O3/c26-19-10-6-17(7-11-19)22(18-8-12-20(27)13-9-18)23(29-30-28)24(32)31-21(15-34-25(31)33)14-16-4-2-1-3-5-16/h1-13,21-23H,14-15H2 |
| InChIKey | WMRHOKNQEDMBHH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|