C24H28N4O5 — CID 54221505
3-[(2S)-2-azido-6,6-dimethoxy-4-phenylhexanoyl]-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 54221505) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3-[(2S)-2-azido-6,6-dimethoxy-4-phenylhexanoyl]-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2S)-2-azido-6,6-dimethoxy-4-phenylhexanoyl]-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54221505 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[(2S)-2-azido-6,6-dimethoxy-4-phenylhexanoyl]-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | COC(CC(C[C@H](N=[N+]=[N-])C(=O)N1C(=O)OCC1Cc1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C24H28N4O5/c1-31-22(32-2)15-19(18-11-7-4-8-12-18)14-21(26-27-25)23(29)28-20(16-33-24(28)30)13-17-9-5-3-6-10-17/h3-12,19-22H,13-16H2,1-2H3/t19?,20?,21-/m0/s1 |
| InChIKey | QCXDJSOIHMIIFF-CBNMVNINSA-N |
| XLogP | 4.44 |
| TPSA | 113.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|