C26H34N4O5Si — CID 10768028
(4S)-3-[(2S)-2-azido-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]propanoyl]-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 10768028) has the molecular formula C26H34N4O5Si and a molecular weight of 510.67 g/mol. Its IUPAC name is (4S)-3-[(2S)-2-azido-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]propanoyl]-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S)-2-azido-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]propanoyl]-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10768028 |
| Molecular Formula | C26H34N4O5Si |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (4S)-3-[(2S)-2-azido-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]propanoyl]-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(C[C@H](N=[N+]=[N-])C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H34N4O5Si/c1-26(2,3)36(5,6)35-23-16-19(12-13-22(23)33-4)15-21(28-29-27)24(31)30-20(17-34-25(30)32)14-18-10-8-7-9-11-18/h7-13,16,20-21H,14-15,17H2,1-6H3/t20-,21-/m0/s1 |
| InChIKey | QYMXAPUOKKFEHL-SFTDATJTSA-N |
| XLogP | 5.89 |
| TPSA | 113.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|