C24H27NO5 — CID 57409325
(4S)-4-benzyl-3-[(2S)-2-[(3,4-dimethoxyphenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 57409325) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-2-[(3,4-dimethoxyphenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-2-[(3,4-dimethoxyphenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 57409325 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-2-[(3,4-dimethoxyphenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@@H](Cc1ccc(OC)c(OC)c1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H27NO5/c1-4-8-19(13-18-11-12-21(28-2)22(15-18)29-3)23(26)25-20(16-30-24(25)27)14-17-9-6-5-7-10-17/h4-7,9-12,15,19-20H,1,8,13-14,16H2,2-3H3/t19-,20-/m0/s1 |
| InChIKey | XUVLIFFCYZIZGN-PMACEKPBSA-N |
| XLogP | 4.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|