C30H31NO5 — CID 134834760
4-benzyl-3-[(2R)-2-[(3-methoxy-4-phenylmethoxyphenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 134834760) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-benzyl-3-[(2R)-2-[(3-methoxy-4-phenylmethoxyphenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[(2R)-2-[(3-methoxy-4-phenylmethoxyphenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134834760 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 4-benzyl-3-[(2R)-2-[(3-methoxy-4-phenylmethoxyphenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](Cc1ccc(OCc2ccccc2)c(OC)c1)C(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C30H31NO5/c1-3-10-25(29(32)31-26(21-36-30(31)33)18-22-11-6-4-7-12-22)17-24-15-16-27(28(19-24)34-2)35-20-23-13-8-5-9-14-23/h3-9,11-16,19,25-26H,1,10,17-18,20-21H2,2H3/t25-,26?/m1/s1 |
| InChIKey | AVZCTNAZGMHYJE-DCWQJPKNSA-N |
| XLogP | 5.60 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|