C30H31NO5 — CID 87353998
4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-3-[(2,6-dimethyl-4-phenylmethoxyphenyl)methyl]-4-oxobutanal (PubChem CID 87353998) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-3-[(2,6-dimethyl-4-phenylmethoxyphenyl)methyl]-4-oxobutanal.
| Compound Name | 4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-3-[(2,6-dimethyl-4-phenylmethoxyphenyl)methyl]-4-oxobutanal |
|---|---|
| PubChem CID | 87353998 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 4-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-3-[(2,6-dimethyl-4-phenylmethoxyphenyl)methyl]-4-oxobutanal |
| SMILES | Cc1cc(OCc2ccccc2)cc(C)c1CC(CC=O)C(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C30H31NO5/c1-21-15-27(35-19-24-11-7-4-8-12-24)16-22(2)28(21)18-25(13-14-32)29(33)31-26(20-36-30(31)34)17-23-9-5-3-6-10-23/h3-12,14-16,25-26H,13,17-20H2,1-2H3 |
| InChIKey | NUXITWOJHDXZNQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|