C25H28FNO4 — CID 59512602
(5S)-6-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-oxohexanal (PubChem CID 59512602) has the molecular formula C25H28FNO4 and a molecular weight of 425.50 g/mol. Its IUPAC name is (5S)-6-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-oxohexanal.
| Compound Name | (5S)-6-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-oxohexanal |
|---|---|
| PubChem CID | 59512602 |
| Molecular Formula | C25H28FNO4 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (5S)-6-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-oxohexanal |
| SMILES | Cc1cc(C[C@H](CCCC=O)C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)cc(C)c1F |
| InChI | InChI=1S/C25H28FNO4/c1-17-12-20(13-18(2)23(17)26)14-21(10-6-7-11-28)24(29)27-22(16-31-25(27)30)15-19-8-4-3-5-9-19/h3-5,8-9,11-13,21-22H,6-7,10,14-16H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | PGLJXUXCQXRDCP-FCHUYYIVSA-N |
| XLogP | 4.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|