C40H37FN2O6 — CID 123489448
5-benzyl-1,6-bis[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(4-fluorophenyl)methyl]hex-2-ene-1,6-dione (PubChem CID 123489448) has the molecular formula C40H37FN2O6 and a molecular weight of 660.74 g/mol. Its IUPAC name is 5-benzyl-1,6-bis[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(4-fluorophenyl)methyl]hex-2-ene-1,6-dione.
| Compound Name | 5-benzyl-1,6-bis[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(4-fluorophenyl)methyl]hex-2-ene-1,6-dione |
|---|---|
| PubChem CID | 123489448 |
| Molecular Formula | C40H37FN2O6 |
| Molecular Weight | 660.74 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 5-benzyl-1,6-bis[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(4-fluorophenyl)methyl]hex-2-ene-1,6-dione |
| SMILES | O=C1OC[C@H](Cc2ccccc2)N1C(=O)C(=CCC(Cc1ccccc1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C40H37FN2O6/c41-34-20-16-31(17-21-34)23-33(38(45)43-36(27-49-40(43)47)25-30-14-8-3-9-15-30)19-18-32(22-28-10-4-1-5-11-28)37(44)42-35(26-48-39(42)46)24-29-12-6-2-7-13-29/h1-17,19-21,32,35-36H,18,22-27H2/t32?,35-,36-/m0/s1 |
| InChIKey | SPQUDSBRZUYGMW-YHAMMETKSA-N |
| XLogP | 6.72 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|