C20H15F4NO3 — CID 68726541
(4S)-4-benzyl-3-[(E)-4,4,4-trifluoro-3-(4-fluorophenyl)but-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 68726541) has the molecular formula C20H15F4NO3 and a molecular weight of 393.34 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E)-4,4,4-trifluoro-3-(4-fluorophenyl)but-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E)-4,4,4-trifluoro-3-(4-fluorophenyl)but-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 68726541 |
| Molecular Formula | C20H15F4NO3 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (4S)-4-benzyl-3-[(E)-4,4,4-trifluoro-3-(4-fluorophenyl)but-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C(\c1ccc(F)cc1)C(F)(F)F)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H15F4NO3/c21-15-8-6-14(7-9-15)17(20(22,23)24)11-18(26)25-16(12-28-19(25)27)10-13-4-2-1-3-5-13/h1-9,11,16H,10,12H2/b17-11+/t16-/m0/s1 |
| InChIKey | XOXRZKGDWGKCLJ-KTZOAPACSA-N |
| XLogP | 4.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|