C14H14F3NO3 — CID 71477692
(4S)-4-benzyl-3-(4,4,4-trifluorobutanoyl)-1,3-oxazolidin-2-one (PubChem CID 71477692) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(4,4,4-trifluorobutanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(4,4,4-trifluorobutanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71477692 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (4S)-4-benzyl-3-(4,4,4-trifluorobutanoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CCC(F)(F)F)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H14F3NO3/c15-14(16,17)7-6-12(19)18-11(9-21-13(18)20)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2/t11-/m0/s1 |
| InChIKey | XPGZSCXWDAPVIM-NSHDSACASA-N |
| XLogP | 2.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |