C22H25NO3 — CID 70251380
(4R)-4-benzyl-3-(6-phenylhexanoyl)-1,3-oxazolidin-2-one (PubChem CID 70251380) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (4R)-4-benzyl-3-(6-phenylhexanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-(6-phenylhexanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70251380 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (4R)-4-benzyl-3-(6-phenylhexanoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CCCCCc1ccccc1)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c24-21(15-9-3-6-12-18-10-4-1-5-11-18)23-20(17-26-22(23)25)16-19-13-7-2-8-14-19/h1-2,4-5,7-8,10-11,13-14,20H,3,6,9,12,15-17H2/t20-/m1/s1 |
| InChIKey | ICSPMLXDQHTSGU-HXUWFJFHSA-N |
| XLogP | 4.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|