C20H21NO3 — CID 10592004
(4S)-4-benzyl-3-(4-phenylbutanoyl)-1,3-oxazolidin-2-one (PubChem CID 10592004) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(4-phenylbutanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(4-phenylbutanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10592004 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (4S)-4-benzyl-3-(4-phenylbutanoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CCCc1ccccc1)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c22-19(13-7-12-16-8-3-1-4-9-16)21-18(15-24-20(21)23)14-17-10-5-2-6-11-17/h1-6,8-11,18H,7,12-15H2/t18-/m0/s1 |
| InChIKey | YBRNOEDQAAWPSA-SFHVURJKSA-N |
| XLogP | 3.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |