C20H22N2O3 — CID 23373753
4-benzyl-3-(5-pyridin-4-ylpentanoyl)-1,3-oxazolidin-2-one (PubChem CID 23373753) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-benzyl-3-(5-pyridin-4-ylpentanoyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-(5-pyridin-4-ylpentanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23373753 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-benzyl-3-(5-pyridin-4-ylpentanoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CCCCc1ccncc1)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O3/c23-19(9-5-4-6-16-10-12-21-13-11-16)22-18(15-25-20(22)24)14-17-7-2-1-3-8-17/h1-3,7-8,10-13,18H,4-6,9,14-15H2 |
| InChIKey | IJDWGOMWBUELIF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|