C27H35N3O3 — CID 54245347
(4S)-4-benzyl-3-[9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoyl]-1,3-oxazolidin-2-one (PubChem CID 54245347) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54245347 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (4S)-4-benzyl-3-[9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CCCCCCCCc1ccc2c(n1)NCCC2)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H35N3O3/c31-25(30-24(20-33-27(30)32)19-21-11-6-5-7-12-21)15-9-4-2-1-3-8-14-23-17-16-22-13-10-18-28-26(22)29-23/h5-7,11-12,16-17,24H,1-4,8-10,13-15,18-20H2,(H,28,29)/t24-/m0/s1 |
| InChIKey | QSXDFNGGOIDGOJ-DEOSSOPVSA-N |
| XLogP | 5.30 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|