C25H32N4O3 — CID 142418869
(2R)-2-phenyl-2-[4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoyl]piperazin-1-yl]acetic acid (PubChem CID 142418869) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoyl]piperazin-1-yl]acetic acid.
| Compound Name | (2R)-2-phenyl-2-[4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 142418869 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (2R)-2-phenyl-2-[4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)[C@@H](c1ccccc1)N1CCN(C(=O)CCCCc2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C25H32N4O3/c30-22(11-5-4-10-21-13-12-20-9-6-14-26-24(20)27-21)28-15-17-29(18-16-28)23(25(31)32)19-7-2-1-3-8-19/h1-3,7-8,12-13,23H,4-6,9-11,14-18H2,(H,26,27)(H,31,32)/t23-/m1/s1 |
| InChIKey | QJYJVEKTKSFLKF-HSZRJFAPSA-N |
| XLogP | 3.12 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|