C25H31F2N3O2 — CID 146486005
2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-phenylacetic acid (PubChem CID 146486005) has the molecular formula C25H31F2N3O2 and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-phenylacetic acid.
| Compound Name | 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 146486005 |
| Molecular Formula | C25H31F2N3O2 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1CC[C@@H](C(F)(F)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C25H31F2N3O2/c26-25(27,14-5-4-10-21-12-11-19-9-6-15-28-23(19)29-21)20-13-16-30(17-20)22(24(31)32)18-7-2-1-3-8-18/h1-3,7-8,11-12,20,22H,4-6,9-10,13-17H2,(H,28,29)(H,31,32)/t20-,22?/m1/s1 |
| InChIKey | HRPYYDLZMFOTLL-PSDZMVHGSA-N |
| XLogP | 4.94 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|