C30H37F2N5O2 — CID 146430742
2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-5-yl]-2-[3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid (PubChem CID 146430742) has the molecular formula C30H37F2N5O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-5-yl]-2-[3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-5-yl]-2-[3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146430742 |
| Molecular Formula | C30H37F2N5O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-5-yl]-2-[3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1cnc2c(ccn2CC2CC2)c1)N1CCC(C(F)(F)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C30H37F2N5O2/c31-30(32,12-2-1-5-25-9-8-21-4-3-13-33-27(21)35-25)24-11-15-36(19-24)26(29(38)39)23-16-22-10-14-37(18-20-6-7-20)28(22)34-17-23/h8-10,14,16-17,20,24,26H,1-7,11-13,15,18-19H2,(H,33,35)(H,38,39) |
| InChIKey | UHKXDVZZLPTSHK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|