C30H38F3N3O4 — CID 146486153
2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]acetic acid (PubChem CID 146486153) has the molecular formula C30H38F3N3O4 and a molecular weight of 561.65 g/mol. Its IUPAC name is 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 146486153 |
| Molecular Formula | C30H38F3N3O4 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]acetic acid |
| SMILES | O=C(O)C(c1cc(F)ccc1OC[C@H]1CCOC1)N1CC[C@@H](C(F)(F)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C30H38F3N3O4/c31-23-7-9-26(40-19-20-11-15-39-18-20)25(16-23)27(29(37)38)36-14-10-22(17-36)30(32,33)12-2-1-5-24-8-6-21-4-3-13-34-28(21)35-24/h6-9,16,20,22,27H,1-5,10-15,17-19H2,(H,34,35)(H,37,38)/t20-,22+,27?/m0/s1 |
| InChIKey | VSVLMOGTCJOIOA-VYEWMXHSSA-N |
| XLogP | 5.49 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|