C33H45F3N4O3 — CID 146486084
tert-butyl 2-[3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxan-2-yl)-3-pyridinyl]acetate (PubChem CID 146486084) has the molecular formula C33H45F3N4O3 and a molecular weight of 602.74 g/mol. Its IUPAC name is tert-butyl 2-[3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxan-2-yl)-3-pyridinyl]acetate.
| Compound Name | tert-butyl 2-[3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxan-2-yl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 146486084 |
| Molecular Formula | C33H45F3N4O3 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | tert-butyl 2-[3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxan-2-yl)-3-pyridinyl]acetate |
| SMILES | CC(C)(C)OC(=O)C(c1cc(F)cnc1C1CCCCO1)N1CCC(C(F)(F)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C33H45F3N4O3/c1-32(2,3)43-31(41)29(26-19-24(34)20-38-28(26)27-11-5-7-18-42-27)40-17-14-23(21-40)33(35,36)15-6-4-10-25-13-12-22-9-8-16-37-30(22)39-25/h12-13,19-20,23,27,29H,4-11,14-18,21H2,1-3H3,(H,37,39) |
| InChIKey | SBXYOHFQZYWLEP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|