C29H36F3N3O4 — CID 146486115
2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxetan-3-yloxymethyl)phenyl]acetic acid (PubChem CID 146486115) has the molecular formula C29H36F3N3O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxetan-3-yloxymethyl)phenyl]acetic acid.
| Compound Name | 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxetan-3-yloxymethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 146486115 |
| Molecular Formula | C29H36F3N3O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 2-[(3R)-3-[1,1-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-(oxetan-3-yloxymethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(c1cc(F)ccc1COC1COC1)N1CC[C@@H](C(F)(F)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C29H36F3N3O4/c30-22-8-6-20(16-39-24-17-38-18-24)25(14-22)26(28(36)37)35-13-10-21(15-35)29(31,32)11-2-1-5-23-9-7-19-4-3-12-33-27(19)34-23/h6-9,14,21,24,26H,1-5,10-13,15-18H2,(H,33,34)(H,36,37)/t21-,26?/m1/s1 |
| InChIKey | MZICRQWTLSBVPL-OSMGYRLQSA-N |
| XLogP | 4.99 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|