C32H43F2N3O5 — CID 170053453
2-[(3R)-3-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-methyl-2-[[(3S)-oxolan-3-yl]oxymethyl]phenyl]acetic acid (PubChem CID 170053453) has the molecular formula C32H43F2N3O5 and a molecular weight of 587.71 g/mol. Its IUPAC name is 2-[(3R)-3-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-methyl-2-[[(3S)-oxolan-3-yl]oxymethyl]phenyl]acetic acid.
| Compound Name | 2-[(3R)-3-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-methyl-2-[[(3S)-oxolan-3-yl]oxymethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 170053453 |
| Molecular Formula | C32H43F2N3O5 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 2-[(3R)-3-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-methyl-2-[[(3S)-oxolan-3-yl]oxymethyl]phenyl]acetic acid |
| SMILES | COc1cc(CCCCC(F)(F)[C@@H]2CCN(C(C(=O)O)c3cc(C)ccc3CO[C@H]3CCOC3)C2)nc2c1CCCN2 |
| InChI | InChI=1S/C32H43F2N3O5/c1-21-8-9-22(19-42-25-11-15-41-20-25)27(16-21)29(31(38)39)37-14-10-23(18-37)32(33,34)12-4-3-6-24-17-28(40-2)26-7-5-13-35-30(26)36-24/h8-9,16-17,23,25,29H,3-7,10-15,18-20H2,1-2H3,(H,35,36)(H,38,39)/t23-,25+,29?/m1/s1 |
| InChIKey | AHKDSUXKBLEGNN-WHZDWUEFSA-N |
| XLogP | 5.56 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|