C29H39FN4O3 — CID 170053531
2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[2-fluoro-6-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hexan-2-yl]pyrrolidin-1-yl]acetic acid (PubChem CID 170053531) has the molecular formula C29H39FN4O3 and a molecular weight of 510.65 g/mol. Its IUPAC name is 2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[2-fluoro-6-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hexan-2-yl]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[2-fluoro-6-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hexan-2-yl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 170053531 |
| Molecular Formula | C29H39FN4O3 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | 2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[2-fluoro-6-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hexan-2-yl]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(CCCCC(C)(F)[C@@H]2CCN(C(C(=O)O)c3cccnc3C3CC3)C2)nc2c1CCCN2 |
| InChI | InChI=1S/C29H39FN4O3/c1-29(30,13-4-3-7-21-17-24(37-2)22-8-5-15-32-27(22)33-21)20-12-16-34(18-20)26(28(35)36)23-9-6-14-31-25(23)19-10-11-19/h6,9,14,17,19-20,26H,3-5,7-8,10-13,15-16,18H2,1-2H3,(H,32,33)(H,35,36)/t20-,26?,29?/m1/s1 |
| InChIKey | VRMAWHNMZQSZMS-HTOVQITJSA-N |
| XLogP | 5.31 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|