C27H36N4O2 — CID 146433032
(2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid (PubChem CID 146433032) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146433032 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@H](c1cccnc1C1CC1)N1CC[C@@H](CCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C27H36N4O2/c32-27(33)25(23-9-5-15-28-24(23)20-10-11-20)31-17-14-19(18-31)6-2-1-3-8-22-13-12-21-7-4-16-29-26(21)30-22/h5,9,12-13,15,19-20,25H,1-4,6-8,10-11,14,16-18H2,(H,29,30)(H,32,33)/t19-,25+/m1/s1 |
| InChIKey | NDMVMOPTFPJNKR-CLOONOSVSA-N |
| XLogP | 4.96 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|