C29H38F2N4O2 — CID 146486036
ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[2,2-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate (PubChem CID 146486036) has the molecular formula C29H38F2N4O2 and a molecular weight of 512.65 g/mol. Its IUPAC name is ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[2,2-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate.
| Compound Name | ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[2,2-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 146486036 |
| Molecular Formula | C29H38F2N4O2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[2,2-difluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)C(c1cccnc1C1CC1)N1CCC(CC(F)(F)CCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C29H38F2N4O2/c1-2-37-28(36)26(24-8-5-15-32-25(24)21-9-10-21)35-17-13-20(19-35)18-29(30,31)14-3-7-23-12-11-22-6-4-16-33-27(22)34-23/h5,8,11-12,15,20-21,26H,2-4,6-7,9-10,13-14,16-19H2,1H3,(H,33,34) |
| InChIKey | YCVDMQJIBHGPON-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |