C28H39N4O2P — CID 170052183
methyl (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1-phosphanyl-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate (PubChem CID 170052183) has the molecular formula C28H39N4O2P and a molecular weight of 494.62 g/mol. Its IUPAC name is methyl (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1-phosphanyl-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate.
| Compound Name | methyl (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1-phosphanyl-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 170052183 |
| Molecular Formula | C28H39N4O2P |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | methyl (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1-phosphanyl-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate |
| SMILES | COC(=O)[C@H](c1cccnc1C1CC1)N1CCC(C(P)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C28H39N4O2P/c1-34-28(33)26(23-8-5-15-29-25(23)19-10-11-19)32-17-14-21(18-32)24(35)9-3-2-7-22-13-12-20-6-4-16-30-27(20)31-22/h5,8,12-13,15,19,21,24,26H,2-4,6-7,9-11,14,16-18,35H2,1H3,(H,30,31)/t21?,24?,26-/m0/s1 |
| InChIKey | NZOGUKUEHSUYFH-QVKCHMKDSA-N |
| XLogP | 4.90 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|