C32H43F3N4O2 — CID 146564615
tert-butyl 2-[2-(3,3-difluorocyclobutyl)-3-pyridinyl]-2-[3-[1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate (PubChem CID 146564615) has the molecular formula C32H43F3N4O2 and a molecular weight of 572.72 g/mol. Its IUPAC name is tert-butyl 2-[2-(3,3-difluorocyclobutyl)-3-pyridinyl]-2-[3-[1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-(3,3-difluorocyclobutyl)-3-pyridinyl]-2-[3-[1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 146564615 |
| Molecular Formula | C32H43F3N4O2 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | tert-butyl 2-[2-(3,3-difluorocyclobutyl)-3-pyridinyl]-2-[3-[1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C(c1cccnc1C1CC(F)(F)C1)N1CCC(C(F)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C32H43F3N4O2/c1-31(2,3)41-30(40)28(25-10-7-15-36-27(25)23-18-32(34,35)19-23)39-17-14-22(20-39)26(33)11-5-4-9-24-13-12-21-8-6-16-37-29(21)38-24/h7,10,12-13,15,22-23,26,28H,4-6,8-9,11,14,16-20H2,1-3H3,(H,37,38) |
| InChIKey | UBPWZZYUCKRNMV-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|