C30H41FN4O3 — CID 146564544
ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1-fluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate (PubChem CID 146564544) has the molecular formula C30H41FN4O3 and a molecular weight of 524.68 g/mol. Its IUPAC name is ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1-fluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate.
| Compound Name | ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1-fluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 146564544 |
| Molecular Formula | C30H41FN4O3 |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1-fluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)C(c1cccnc1C1CC1)N1CCC(C(F)CCCCc2cc(OC)c3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C30H41FN4O3/c1-3-38-30(36)28(24-10-7-15-32-27(24)20-12-13-20)35-17-14-21(19-35)25(31)11-5-4-8-22-18-26(37-2)23-9-6-16-33-29(23)34-22/h7,10,15,18,20-21,25,28H,3-6,8-9,11-14,16-17,19H2,1-2H3,(H,33,34) |
| InChIKey | MOULNUFEPCAMME-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|