C29H40IN4O3P — CID 170051868
methyl (2R)-2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[(1S)-5-(8-iodo-4-methoxy-6,7-dihydro-5H-1,8-naphthyridin-2-yl)-1-phosphanylpentyl]pyrrolidin-1-yl]acetate (PubChem CID 170051868) has the molecular formula C29H40IN4O3P and a molecular weight of 650.54 g/mol. Its IUPAC name is methyl (2R)-2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[(1S)-5-(8-iodo-4-methoxy-6,7-dihydro-5H-1,8-naphthyridin-2-yl)-1-phosphanylpentyl]pyrrolidin-1-yl]acetate.
| Compound Name | methyl (2R)-2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[(1S)-5-(8-iodo-4-methoxy-6,7-dihydro-5H-1,8-naphthyridin-2-yl)-1-phosphanylpentyl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 170051868 |
| Molecular Formula | C29H40IN4O3P |
| Molecular Weight | 650.54 g/mol |
| Exact Mass | 650.19 |
| IUPAC Name | methyl (2R)-2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[(1S)-5-(8-iodo-4-methoxy-6,7-dihydro-5H-1,8-naphthyridin-2-yl)-1-phosphanylpentyl]pyrrolidin-1-yl]acetate |
| SMILES | COC(=O)[C@@H](c1cccnc1C1CC1)N1CC[C@@H]([C@@H](P)CCCCc2cc(OC)c3c(n2)N(I)CCC3)C1 |
| InChI | InChI=1S/C29H40IN4O3P/c1-36-24-17-21(32-28-22(24)9-6-15-34(28)30)7-3-4-10-25(38)20-13-16-33(18-20)27(29(35)37-2)23-8-5-14-31-26(23)19-11-12-19/h5,8,14,17,19-20,25,27H,3-4,6-7,9-13,15-16,18,38H2,1-2H3/t20-,25+,27-/m1/s1 |
| InChIKey | SPYFIDMVKAONLL-ZBKJKTKLSA-N |
| XLogP | 5.66 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|