C28H36F2N4O3 — CID 146486162
2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid (PubChem CID 146486162) has the molecular formula C28H36F2N4O3 and a molecular weight of 514.62 g/mol. Its IUPAC name is 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146486162 |
| Molecular Formula | C28H36F2N4O3 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 2-(2-cyclopropyl-3-pyridinyl)-2-[3-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(CCCCC(F)(F)C2CCN(C(C(=O)O)c3cccnc3C3CC3)C2)nc2c1CCCN2 |
| InChI | InChI=1S/C28H36F2N4O3/c1-37-23-16-20(33-26-21(23)7-4-14-32-26)6-2-3-12-28(29,30)19-11-15-34(17-19)25(27(35)36)22-8-5-13-31-24(22)18-9-10-18/h5,8,13,16,18-19,25H,2-4,6-7,9-12,14-15,17H2,1H3,(H,32,33)(H,35,36) |
| InChIKey | LCJKGGSLHFTNCY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|