C18H27F2N3O — CID 146425936
7-[5,5-difluoro-5-[(3R)-pyrrolidin-3-yl]pentyl]-5-methoxy-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 146425936) has the molecular formula C18H27F2N3O and a molecular weight of 339.43 g/mol. Its IUPAC name is 7-[5,5-difluoro-5-[(3R)-pyrrolidin-3-yl]pentyl]-5-methoxy-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-[5,5-difluoro-5-[(3R)-pyrrolidin-3-yl]pentyl]-5-methoxy-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 146425936 |
| Molecular Formula | C18H27F2N3O |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 7-[5,5-difluoro-5-[(3R)-pyrrolidin-3-yl]pentyl]-5-methoxy-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | COc1cc(CCCCC(F)(F)[C@@H]2CCNC2)nc2c1CCCN2 |
| InChI | InChI=1S/C18H27F2N3O/c1-24-16-11-14(23-17-15(16)6-4-9-22-17)5-2-3-8-18(19,20)13-7-10-21-12-13/h11,13,21H,2-10,12H2,1H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | WNEGFBDFLKUXBW-CYBMUJFWSA-N |
| XLogP | 3.41 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|