C33H47N3O5 — CID 177029489
butan-2-yl 2-(2-cyclopropyl-3-methoxyphenyl)-2-[3-[5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetate (PubChem CID 177029489) has the molecular formula C33H47N3O5 and a molecular weight of 565.76 g/mol. Its IUPAC name is butan-2-yl 2-(2-cyclopropyl-3-methoxyphenyl)-2-[3-[5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetate.
| Compound Name | butan-2-yl 2-(2-cyclopropyl-3-methoxyphenyl)-2-[3-[5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 177029489 |
| Molecular Formula | C33H47N3O5 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | butan-2-yl 2-(2-cyclopropyl-3-methoxyphenyl)-2-[3-[5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetate |
| SMILES | CCC(C)OC(=O)C(c1cccc(OC)c1C1CC1)N1CC(OCCCCCc2cc(OC)c3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C33H47N3O5/c1-5-22(2)41-33(37)31(27-12-9-14-28(38-3)30(27)23-15-16-23)36-20-25(21-36)40-18-8-6-7-11-24-19-29(39-4)26-13-10-17-34-32(26)35-24/h9,12,14,19,22-23,25,31H,5-8,10-11,13,15-18,20-21H2,1-4H3,(H,34,35) |
| InChIKey | XJBOYWZJDMSBNI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|