C31H41F2N3O5 — CID 163961588
2-[2-(5,5-difluorooxan-2-yl)-5-methylphenyl]-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 163961588) has the molecular formula C31H41F2N3O5 and a molecular weight of 573.68 g/mol. Its IUPAC name is 2-[2-(5,5-difluorooxan-2-yl)-5-methylphenyl]-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(5,5-difluorooxan-2-yl)-5-methylphenyl]-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 163961588 |
| Molecular Formula | C31H41F2N3O5 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 2-[2-(5,5-difluorooxan-2-yl)-5-methylphenyl]-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(CCCCO[C@@H]2CCN(C(C(=O)O)c3cc(C)ccc3C3CCC(F)(F)CO3)C2)nc2c1CCCN2 |
| InChI | InChI=1S/C31H41F2N3O5/c1-20-8-9-23(26-10-12-31(32,33)19-41-26)25(16-20)28(30(37)38)36-14-11-22(18-36)40-15-4-3-6-21-17-27(39-2)24-7-5-13-34-29(24)35-21/h8-9,16-17,22,26,28H,3-7,10-15,18-19H2,1-2H3,(H,34,35)(H,37,38)/t22-,26?,28?/m1/s1 |
| InChIKey | KPCDHLMTJBQWMR-MILJFOEMSA-N |
| XLogP | 5.48 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|