C29H36N4O5 — CID 146425693
2-(3-methoxyquinolin-5-yl)-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146425693) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-(3-methoxyquinolin-5-yl)-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(3-methoxyquinolin-5-yl)-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146425693 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 2-(3-methoxyquinolin-5-yl)-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cnc2cccc(C(C(=O)O)N3CCC(OCCCCc4cc(OC)c5c(n4)NCCC5)C3)c2c1 |
| InChI | InChI=1S/C29H36N4O5/c1-36-21-16-24-22(8-5-10-25(24)31-17-21)27(29(34)35)33-13-11-20(18-33)38-14-4-3-7-19-15-26(37-2)23-9-6-12-30-28(23)32-19/h5,8,10,15-17,20,27H,3-4,6-7,9,11-14,18H2,1-2H3,(H,30,32)(H,34,35) |
| InChIKey | ONBOULCTIMQKIX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|