C29H40N4O4 — CID 146423052
ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate (PubChem CID 146423052) has the molecular formula C29H40N4O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate.
| Compound Name | ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 146423052 |
| Molecular Formula | C29H40N4O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | ethyl 2-(2-cyclopropyl-3-pyridinyl)-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)C(c1cccnc1C1CC1)N1CC[C@@H](OCCCCc2cc(OC)c3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C29H40N4O4/c1-3-36-29(34)27(24-10-7-14-30-26(24)20-11-12-20)33-16-13-22(19-33)37-17-5-4-8-21-18-25(35-2)23-9-6-15-31-28(23)32-21/h7,10,14,18,20,22,27H,3-6,8-9,11-13,15-17,19H2,1-2H3,(H,31,32)/t22-,27?/m1/s1 |
| InChIKey | WDSXCDMFSJMTLE-XVPAFAEQSA-N |
| XLogP | 4.44 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|