C31H45N3O4 — CID 177029555
2-(2-cyclopropyl-3-methoxyphenyl)-2-[3-[5-(6-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid;ethane (PubChem CID 177029555) has the molecular formula C31H45N3O4 and a molecular weight of 523.72 g/mol. Its IUPAC name is 2-(2-cyclopropyl-3-methoxyphenyl)-2-[3-[5-(6-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid;ethane.
| Compound Name | 2-(2-cyclopropyl-3-methoxyphenyl)-2-[3-[5-(6-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 177029555 |
| Molecular Formula | C31H45N3O4 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | 2-(2-cyclopropyl-3-methoxyphenyl)-2-[3-[5-(6-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid;ethane |
| SMILES | CC.COc1cccc(C(C(=O)O)N2CC(OCCCCCc3ccc4c(n3)NCC(C)C4)C2)c1C1CC1 |
| InChI | InChI=1S/C29H39N3O4.C2H6/c1-19-15-21-12-13-22(31-28(21)30-16-19)7-4-3-5-14-36-23-17-32(18-23)27(29(33)34)24-8-6-9-25(35-2)26(24)20-10-11-20;1-2/h6,8-9,12-13,19-20,23,27H,3-5,7,10-11,14-18H2,1-2H3,(H,30,31)(H,33,34);1-2H3 |
| InChIKey | GSDNAMVDFVQPEY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|