C26H35N5O3 — CID 177029256
2-[2-amino-3-(methyliminomethyl)phenyl]-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid (PubChem CID 177029256) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 2-[2-amino-3-(methyliminomethyl)phenyl]-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid.
| Compound Name | 2-[2-amino-3-(methyliminomethyl)phenyl]-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 177029256 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 2-[2-amino-3-(methyliminomethyl)phenyl]-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid |
| SMILES | C/N=C/c1cccc(C(C(=O)O)N2CC(OCCCCCc3ccc4c(n3)NCCC4)C2)c1N |
| InChI | InChI=1S/C26H35N5O3/c1-28-15-19-7-5-10-22(23(19)27)24(26(32)33)31-16-21(17-31)34-14-4-2-3-9-20-12-11-18-8-6-13-29-25(18)30-20/h5,7,10-12,15,21,24H,2-4,6,8-9,13-14,16-17,27H2,1H3,(H,29,30)(H,32,33)/b28-15+ |
| InChIKey | AYXOMEVPGWAMGH-RWPZCVJISA-N |
| XLogP | 3.31 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|