C26H34FN5O3 — CID 177029505
2-(3-amino-2-ethanimidoyl-5-fluorophenyl)-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid (PubChem CID 177029505) has the molecular formula C26H34FN5O3 and a molecular weight of 483.59 g/mol. Its IUPAC name is 2-(3-amino-2-ethanimidoyl-5-fluorophenyl)-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid.
| Compound Name | 2-(3-amino-2-ethanimidoyl-5-fluorophenyl)-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 177029505 |
| Molecular Formula | C26H34FN5O3 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 2-(3-amino-2-ethanimidoyl-5-fluorophenyl)-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid |
| SMILES | [H]/N=C(\C)c1c(N)cc(F)cc1C(C(=O)O)N1CC(OCCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C26H34FN5O3/c1-16(28)23-21(12-18(27)13-22(23)29)24(26(33)34)32-14-20(15-32)35-11-4-2-3-7-19-9-8-17-6-5-10-30-25(17)31-19/h8-9,12-13,20,24,28H,2-7,10-11,14-15,29H2,1H3,(H,30,31)(H,33,34)/b28-16+ |
| InChIKey | CGBAYQPKGWNOBK-LQKURTRISA-N |
| XLogP | 3.79 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|