C26H33FN4O3 — CID 177029341
2-(2-ethanimidoyl-5-fluorophenyl)-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid (PubChem CID 177029341) has the molecular formula C26H33FN4O3 and a molecular weight of 468.57 g/mol. Its IUPAC name is 2-(2-ethanimidoyl-5-fluorophenyl)-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid.
| Compound Name | 2-(2-ethanimidoyl-5-fluorophenyl)-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 177029341 |
| Molecular Formula | C26H33FN4O3 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-(2-ethanimidoyl-5-fluorophenyl)-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]azetidin-1-yl]acetic acid |
| SMILES | [H]/N=C(/C)c1ccc(F)cc1C(C(=O)O)N1CC(OCCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C26H33FN4O3/c1-17(28)22-11-9-19(27)14-23(22)24(26(32)33)31-15-21(16-31)34-13-4-2-3-7-20-10-8-18-6-5-12-29-25(18)30-20/h8-11,14,21,24,28H,2-7,12-13,15-16H2,1H3,(H,29,30)(H,32,33)/b28-17- |
| InChIKey | QOZLTGYETCPEJL-QRQIAZFYSA-N |
| XLogP | 4.21 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|