C31H40F3N3O5 — CID 169008210
2-[(2R)-2-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-[[(2S)-oxolan-2-yl]oxymethyl]phenyl]acetic acid (PubChem CID 169008210) has the molecular formula C31H40F3N3O5 and a molecular weight of 591.67 g/mol. Its IUPAC name is 2-[(2R)-2-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-[[(2S)-oxolan-2-yl]oxymethyl]phenyl]acetic acid.
| Compound Name | 2-[(2R)-2-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-[[(2S)-oxolan-2-yl]oxymethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 169008210 |
| Molecular Formula | C31H40F3N3O5 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | 2-[(2R)-2-[1,1-difluoro-5-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-[5-fluoro-2-[[(2S)-oxolan-2-yl]oxymethyl]phenyl]acetic acid |
| SMILES | COc1cc(CCCCC(F)(F)[C@H]2CCCN2C(C(=O)O)c2cc(F)ccc2CO[C@H]2CCCO2)nc2c1CCCN2 |
| InChI | InChI=1S/C31H40F3N3O5/c1-40-25-18-22(36-29-23(25)8-4-14-35-29)7-2-3-13-31(33,34)26-9-5-15-37(26)28(30(38)39)24-17-21(32)12-11-20(24)19-42-27-10-6-16-41-27/h11-12,17-18,26-28H,2-10,13-16,19H2,1H3,(H,35,36)(H,38,39)/t26-,27+,28?/m1/s1 |
| InChIKey | NXGPYBWWMLNPOV-ANUFDVCNSA-N |
| XLogP | 5.88 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|