C33H48IN3O5P2 — CID 170052317
(2S)-2-[3-[1-iodo-5-(4-methoxy-8-methyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)-1-phosphanylpentyl]pyrrolidin-1-yl]-2-[2-(oxan-4-yloxymethyl)-5-phosphanylphenyl]acetic acid (PubChem CID 170052317) has the molecular formula C33H48IN3O5P2 and a molecular weight of 755.61 g/mol. Its IUPAC name is (2S)-2-[3-[1-iodo-5-(4-methoxy-8-methyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)-1-phosphanylpentyl]pyrrolidin-1-yl]-2-[2-(oxan-4-yloxymethyl)-5-phosphanylphenyl]acetic acid.
| Compound Name | (2S)-2-[3-[1-iodo-5-(4-methoxy-8-methyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)-1-phosphanylpentyl]pyrrolidin-1-yl]-2-[2-(oxan-4-yloxymethyl)-5-phosphanylphenyl]acetic acid |
|---|---|
| PubChem CID | 170052317 |
| Molecular Formula | C33H48IN3O5P2 |
| Molecular Weight | 755.61 g/mol |
| Exact Mass | 755.21 |
| IUPAC Name | (2S)-2-[3-[1-iodo-5-(4-methoxy-8-methyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)-1-phosphanylpentyl]pyrrolidin-1-yl]-2-[2-(oxan-4-yloxymethyl)-5-phosphanylphenyl]acetic acid |
| SMILES | COc1cc(CCCCC(P)(I)C2CCN([C@H](C(=O)O)c3cc(P)ccc3COC3CCOCC3)C2)nc2c1CCCN2C |
| InChI | InChI=1S/C33H48IN3O5P2/c1-36-14-5-7-27-29(40-2)18-24(35-31(27)36)6-3-4-13-33(34,44)23-10-15-37(20-23)30(32(38)39)28-19-26(43)9-8-22(28)21-42-25-11-16-41-17-12-25/h8-9,18-19,23,25,30H,3-7,10-17,20-21,43-44H2,1-2H3,(H,38,39)/t23?,30-,33?/m0/s1 |
| InChIKey | LXXUHJZIBZTDAL-KNMUEJNMSA-N |
| XLogP | 5.54 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|