C28H39N4O2P — CID 170052322
(2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[3-[5-[(7R)-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]-1-phosphanylpentyl]pyrrolidin-1-yl]acetic acid (PubChem CID 170052322) has the molecular formula C28H39N4O2P and a molecular weight of 494.62 g/mol. Its IUPAC name is (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[3-[5-[(7R)-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]-1-phosphanylpentyl]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[3-[5-[(7R)-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]-1-phosphanylpentyl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 170052322 |
| Molecular Formula | C28H39N4O2P |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | (2S)-2-(2-cyclopropyl-3-pyridinyl)-2-[3-[5-[(7R)-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]-1-phosphanylpentyl]pyrrolidin-1-yl]acetic acid |
| SMILES | C[C@@H]1CCc2ccc(CCCCC(P)C3CCN([C@H](C(=O)O)c4cccnc4C4CC4)C3)nc2N1 |
| InChI | InChI=1S/C28H39N4O2P/c1-18-8-9-20-12-13-22(31-27(20)30-18)5-2-3-7-24(35)21-14-16-32(17-21)26(28(33)34)23-6-4-15-29-25(23)19-10-11-19/h4,6,12-13,15,18-19,21,24,26H,2-3,5,7-11,14,16-17,35H2,1H3,(H,30,31)(H,33,34)/t18-,21?,24?,26+/m1/s1 |
| InChIKey | RBCOLCGILBIJKC-VIJBKYBSSA-N |
| XLogP | 5.20 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|