C28H36F2N4O2 — CID 146564571
(2R)-2-(2-cyclobutyl-5-fluoro-3-pyridinyl)-2-[(3R)-3-[(1S)-1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid (PubChem CID 146564571) has the molecular formula C28H36F2N4O2 and a molecular weight of 498.62 g/mol. Its IUPAC name is (2R)-2-(2-cyclobutyl-5-fluoro-3-pyridinyl)-2-[(3R)-3-[(1S)-1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2R)-2-(2-cyclobutyl-5-fluoro-3-pyridinyl)-2-[(3R)-3-[(1S)-1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146564571 |
| Molecular Formula | C28H36F2N4O2 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | (2R)-2-(2-cyclobutyl-5-fluoro-3-pyridinyl)-2-[(3R)-3-[(1S)-1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@@H](c1cc(F)cnc1C1CCC1)N1CC[C@@H]([C@@H](F)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C28H36F2N4O2/c29-21-15-23(25(32-16-21)18-5-3-6-18)26(28(35)36)34-14-12-20(17-34)24(30)9-2-1-8-22-11-10-19-7-4-13-31-27(19)33-22/h10-11,15-16,18,20,24,26H,1-9,12-14,17H2,(H,31,33)(H,35,36)/t20-,24+,26-/m1/s1 |
| InChIKey | NKUXEOWYWNKVDE-UGIARPQZSA-N |
| XLogP | 5.44 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|