C29H37F2N3O3 — CID 170050864
(2S)-2-[5-fluoro-2-[(2R)-oxolan-2-yl]phenyl]-2-[(3R)-3-[1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid (PubChem CID 170050864) has the molecular formula C29H37F2N3O3 and a molecular weight of 513.63 g/mol. Its IUPAC name is (2S)-2-[5-fluoro-2-[(2R)-oxolan-2-yl]phenyl]-2-[(3R)-3-[1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[5-fluoro-2-[(2R)-oxolan-2-yl]phenyl]-2-[(3R)-3-[1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 170050864 |
| Molecular Formula | C29H37F2N3O3 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (2S)-2-[5-fluoro-2-[(2R)-oxolan-2-yl]phenyl]-2-[(3R)-3-[1-fluoro-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@H](c1cc(F)ccc1[C@H]1CCCO1)N1CC[C@@H](C(F)CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C29H37F2N3O3/c30-21-10-12-23(26-8-4-16-37-26)24(17-21)27(29(35)36)34-15-13-20(18-34)25(31)7-2-1-6-22-11-9-19-5-3-14-32-28(19)33-22/h9-12,17,20,25-27H,1-8,13-16,18H2,(H,32,33)(H,35,36)/t20-,25?,26-,27+/m1/s1 |
| InChIKey | LPRMNDZNQNIBSH-STPXHTAQSA-N |
| XLogP | 5.63 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|