C29H42N4O4 — CID 158462365
methane;(2S)-2-[2-(oxan-2-yl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 158462365) has the molecular formula C29H42N4O4 and a molecular weight of 510.68 g/mol. Its IUPAC name is methane;(2S)-2-[2-(oxan-2-yl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | methane;(2S)-2-[2-(oxan-2-yl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 158462365 |
| Molecular Formula | C29H42N4O4 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | methane;(2S)-2-[2-(oxan-2-yl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | C.O=C(O)[C@H](c1cccnc1C1CCCCO1)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C28H38N4O4.CH4/c33-28(34)26(23-9-6-14-29-25(23)24-10-2-4-18-36-24)32-16-13-22(19-32)35-17-3-1-8-21-12-11-20-7-5-15-30-27(20)31-21;/h6,9,11-12,14,22,24,26H,1-5,7-8,10,13,15-19H2,(H,30,31)(H,33,34);1H4/t22-,24?,26+;/m1./s1 |
| InChIKey | HFIJXXCUGBFMDR-ZZVBRTHHSA-N |
| XLogP | 4.95 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|