C29H38FN3O4 — CID 146417573
(2S)-2-[3-fluoro-2-(oxan-2-yl)phenyl]-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417573) has the molecular formula C29H38FN3O4 and a molecular weight of 511.64 g/mol. Its IUPAC name is (2S)-2-[3-fluoro-2-(oxan-2-yl)phenyl]-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[3-fluoro-2-(oxan-2-yl)phenyl]-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417573 |
| Molecular Formula | C29H38FN3O4 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | (2S)-2-[3-fluoro-2-(oxan-2-yl)phenyl]-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@H](c1cccc(F)c1C1CCCCO1)N1CCC(OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C29H38FN3O4/c30-24-10-5-9-23(26(24)25-11-2-4-18-37-25)27(29(34)35)33-16-14-22(19-33)36-17-3-1-8-21-13-12-20-7-6-15-31-28(20)32-21/h5,9-10,12-13,22,25,27H,1-4,6-8,11,14-19H2,(H,31,32)(H,34,35)/t22?,25?,27-/m0/s1 |
| InChIKey | SXGUTRGBPKNFPT-BCFFDTETSA-N |
| XLogP | 5.06 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|