C26H34N4O3 — CID 135312363
ethyl 2-phenyl-2-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]pyrrolidin-1-yl]acetate (PubChem CID 135312363) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is ethyl 2-phenyl-2-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]pyrrolidin-1-yl]acetate.
| Compound Name | ethyl 2-phenyl-2-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 135312363 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | ethyl 2-phenyl-2-[3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]pyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)C(c1ccccc1)N1CCC(C(=O)NCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C26H34N4O3/c1-2-33-26(32)23(19-8-4-3-5-9-19)30-17-14-21(18-30)25(31)28-16-7-11-22-13-12-20-10-6-15-27-24(20)29-22/h3-5,8-9,12-13,21,23H,2,6-7,10-11,14-18H2,1H3,(H,27,29)(H,28,31) |
| InChIKey | HLDXXLLAYQBLBF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|