C26H31ClN4O2 — CID 157493143
(1R,5S)-3-[1-(2-chlorophenyl)-2-oxopropyl]-N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 157493143) has the molecular formula C26H31ClN4O2 and a molecular weight of 467.01 g/mol. Its IUPAC name is (1R,5S)-3-[1-(2-chlorophenyl)-2-oxopropyl]-N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | (1R,5S)-3-[1-(2-chlorophenyl)-2-oxopropyl]-N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 157493143 |
| Molecular Formula | C26H31ClN4O2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (1R,5S)-3-[1-(2-chlorophenyl)-2-oxopropyl]-N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | CC(=O)C(c1ccccc1Cl)N1C[C@@H]2C(C(=O)NCCCc3ccc4c(n3)NCCC4)[C@@H]2C1 |
| InChI | InChI=1S/C26H31ClN4O2/c1-16(32)24(19-8-2-3-9-22(19)27)31-14-20-21(15-31)23(20)26(33)29-13-5-7-18-11-10-17-6-4-12-28-25(17)30-18/h2-3,8-11,20-21,23-24H,4-7,12-15H2,1H3,(H,28,30)(H,29,33)/t20-,21+,23?,24? |
| InChIKey | UECPUHFSVWPWIX-MNZGCLKASA-N |
| XLogP | 3.65 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|