C27H32ClN3O2 — CID 157167504
1-[(1R,5S)-3-[1-(2-chlorophenyl)-2-oxopropyl]-3-azabicyclo[3.1.0]hexan-6-yl]-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentan-1-one (PubChem CID 157167504) has the molecular formula C27H32ClN3O2 and a molecular weight of 466.03 g/mol. Its IUPAC name is 1-[(1R,5S)-3-[1-(2-chlorophenyl)-2-oxopropyl]-3-azabicyclo[3.1.0]hexan-6-yl]-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentan-1-one.
| Compound Name | 1-[(1R,5S)-3-[1-(2-chlorophenyl)-2-oxopropyl]-3-azabicyclo[3.1.0]hexan-6-yl]-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 157167504 |
| Molecular Formula | C27H32ClN3O2 |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-[(1R,5S)-3-[1-(2-chlorophenyl)-2-oxopropyl]-3-azabicyclo[3.1.0]hexan-6-yl]-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentan-1-one |
| SMILES | CC(=O)C(c1ccccc1Cl)N1C[C@@H]2C(C(=O)CCCCc3ccc4c(n3)NCCC4)[C@@H]2C1 |
| InChI | InChI=1S/C27H32ClN3O2/c1-17(32)26(20-9-3-4-10-23(20)28)31-15-21-22(16-31)25(21)24(33)11-5-2-8-19-13-12-18-7-6-14-29-27(18)30-19/h3-4,9-10,12-13,21-22,25-26H,2,5-8,11,14-16H2,1H3,(H,29,30)/t21-,22+,25?,26? |
| InChIKey | HGOQATAYNCMQFJ-PJYWLYPCSA-N |
| XLogP | 4.88 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|